C22H34N3O7P — CID 172580460
propyl 2-[[[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-phenoxyphosphanyl]amino]propanoate (PubChem CID 172580460) has the molecular formula C22H34N3O7P and a molecular weight of 483.50 g/mol. Its IUPAC name is propyl 2-[[[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propyl 2-[[[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 172580460 |
| Molecular Formula | C22H34N3O7P |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | propyl 2-[[[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-phenoxyphosphanyl]amino]propanoate |
| SMILES | CCCOC(=O)C(C)NP(OCC(CCN(C)/C=C\C(=O)NC=O)OC)Oc1ccccc1 |
| InChI | InChI=1S/C22H34N3O7P/c1-5-15-30-22(28)18(2)24-33(32-19-9-7-6-8-10-19)31-16-20(29-4)11-13-25(3)14-12-21(27)23-17-26/h6-10,12,14,17-18,20,24H,5,11,13,15-16H2,1-4H3,(H,23,26,27)/b14-12- |
| InChIKey | CKRRUZQNQGHBST-OWBHPGMISA-N |
| XLogP | 2.36 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|