C18H25N2O7P — CID 155241399
[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutyl] (2-formylphenyl)methyl hydrogen phosphite (PubChem CID 155241399) has the molecular formula C18H25N2O7P and a molecular weight of 412.38 g/mol. Its IUPAC name is [4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutyl] (2-formylphenyl)methyl hydrogen phosphite.
| Compound Name | [4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutyl] (2-formylphenyl)methyl hydrogen phosphite |
|---|---|
| PubChem CID | 155241399 |
| Molecular Formula | C18H25N2O7P |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxybutyl] (2-formylphenyl)methyl hydrogen phosphite |
| SMILES | COC(CCN(C)/C=C\C(=O)NC=O)COP(O)OCc1ccccc1C=O |
| InChI | InChI=1S/C18H25N2O7P/c1-20(10-8-18(23)19-14-22)9-7-17(25-2)13-27-28(24)26-12-16-6-4-3-5-15(16)11-21/h3-6,8,10-11,14,17,24H,7,9,12-13H2,1-2H3,(H,19,22,23)/b10-8- |
| InChIKey | SSCLSCRIPMAEDM-NTMALXAHSA-N |
| XLogP | 1.37 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|