C17H27N2O4P — CID 59957283
(2S)-N-[(2S)-1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-2-(phosphanylmethylamino)pentanamide (PubChem CID 59957283) has the molecular formula C17H27N2O4P and a molecular weight of 354.39 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-2-(phosphanylmethylamino)pentanamide.
| Compound Name | (2S)-N-[(2S)-1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-2-(phosphanylmethylamino)pentanamide |
|---|---|
| PubChem CID | 59957283 |
| Molecular Formula | C17H27N2O4P |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2S)-N-[(2S)-1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-2-(phosphanylmethylamino)pentanamide |
| SMILES | CCC[C@H](NCP)C(=O)N[C@H](COOC)Cc1ccccc1C=O |
| InChI | InChI=1S/C17H27N2O4P/c1-3-6-16(18-12-24)17(21)19-15(11-23-22-2)9-13-7-4-5-8-14(13)10-20/h4-5,7-8,10,15-16,18H,3,6,9,11-12,24H2,1-2H3,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | FSMLBCGCYCPFIB-HOTGVXAUSA-N |
| XLogP | 1.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|