C18H30N2O4P2 — CID 59957280
N-[1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-5-methylphosphanyl-2-(phosphanylmethylamino)pentanamide (PubChem CID 59957280) has the molecular formula C18H30N2O4P2 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-5-methylphosphanyl-2-(phosphanylmethylamino)pentanamide.
| Compound Name | N-[1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-5-methylphosphanyl-2-(phosphanylmethylamino)pentanamide |
|---|---|
| PubChem CID | 59957280 |
| Molecular Formula | C18H30N2O4P2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[1-(2-formylphenyl)-3-methylperoxypropan-2-yl]-5-methylphosphanyl-2-(phosphanylmethylamino)pentanamide |
| SMILES | COOCC(Cc1ccccc1C=O)NC(=O)C(CCCPC)NCP |
| InChI | InChI=1S/C18H30N2O4P2/c1-23-24-12-16(10-14-6-3-4-7-15(14)11-21)20-18(22)17(19-13-25)8-5-9-26-2/h3-4,6-7,11,16-17,19,26H,5,8-10,12-13,25H2,1-2H3,(H,20,22) |
| InChIKey | UCJPLCQUDXGROL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|