About (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid (PubChem CID 101249353) has the molecular formula C18H13NO5
and a molecular weight of 323.30 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid |
| PubChem CID | 101249353 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid |
| SMILES | O=Cc1ccccc1C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13NO5/c20-10-12-6-2-1-5-11(12)9-15(18(23)24)19-16(21)13-7-3-4-8-14(13)17(19)22/h1-8,10,15H,9H2,(H,23,24)/t15-/m1/s1 |
| InChIKey | FSTMVGCXDMPDKD-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid?
The IUPAC name of (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid (CID 101249353) is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid.
What is the SMILES notation for (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid?
The canonical SMILES for (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid is O=Cc1ccccc1C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid?
The InChIKey is FSTMVGCXDMPDKD-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H13NO5/c20-10-12-6-2-1-5-11(12)9-15(18(23)24)19-16(21)13-7-3-4-8-14(13)17(19)22/h1-8,10,15H,9H2,(H,23,24)/t15-/m1/s1.
What are the key properties of (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid?
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid has a molecular weight of 323.30 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid is sourced from PubChem (CID 101249353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).