C18H13NO5 — CID 101249353
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid (PubChem CID 101249353) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid |
|---|---|
| PubChem CID | 101249353 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(2-formylphenyl)propanoic acid |
| SMILES | O=Cc1ccccc1C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13NO5/c20-10-12-6-2-1-5-11(12)9-15(18(23)24)19-16(21)13-7-3-4-8-14(13)17(19)22/h1-8,10,15H,9H2,(H,23,24)/t15-/m1/s1 |
| InChIKey | FSTMVGCXDMPDKD-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|