C22H18N2O4 — CID 138470171
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1-prop-2-enylindol-3-yl)propanoic acid (PubChem CID 138470171) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1-prop-2-enylindol-3-yl)propanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1-prop-2-enylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 138470171 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1-prop-2-enylindol-3-yl)propanoic acid |
| SMILES | C=CCn1cc(C[C@@H](C(=O)O)N2C(=O)c3ccccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H18N2O4/c1-2-11-23-13-14(15-7-5-6-10-18(15)23)12-19(22(27)28)24-20(25)16-8-3-4-9-17(16)21(24)26/h2-10,13,19H,1,11-12H2,(H,27,28)/t19-/m0/s1 |
| InChIKey | VHNZOWDLNHINII-IBGZPJMESA-N |
| XLogP | 3.12 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|