C13H11NO6 — CID 87103523
2,2,3,3-tetradeuterio-4-(1,3-dioxoisoindol-2-yl)pentanedioic acid (PubChem CID 87103523) has the molecular formula C13H11NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2,2,3,3-tetradeuterio-4-(1,3-dioxoisoindol-2-yl)pentanedioic acid.
| Compound Name | 2,2,3,3-tetradeuterio-4-(1,3-dioxoisoindol-2-yl)pentanedioic acid |
|---|---|
| PubChem CID | 87103523 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2,2,3,3-tetradeuterio-4-(1,3-dioxoisoindol-2-yl)pentanedioic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11NO6/c15-10(16)6-5-9(13(19)20)14-11(17)7-3-1-2-4-8(7)12(14)18/h1-4,9H,5-6H2,(H,15,16)(H,19,20)/i5D2,6D2 |
| InChIKey | FEFFSKLJNYRHQN-NZLXMSDQSA-N |
| XLogP | 0.60 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|