C19H13NO4 — CID 10990785
2-(1,3-dioxoisoindol-2-yl)-5-phenylpent-4-ynoic acid (PubChem CID 10990785) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-5-phenylpent-4-ynoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-5-phenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 10990785 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-5-phenylpent-4-ynoic acid |
| SMILES | O=C(O)C(CC#Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13NO4/c21-17-14-10-4-5-11-15(14)18(22)20(17)16(19(23)24)12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11,16H,12H2,(H,23,24) |
| InChIKey | CDQXQFQYFDNTSN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|