C23H18NO5P — CID 22829099
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-diphenylphosphorylpropanoic acid (PubChem CID 22829099) has the molecular formula C23H18NO5P and a molecular weight of 419.37 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-diphenylphosphorylpropanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-diphenylphosphorylpropanoic acid |
|---|---|
| PubChem CID | 22829099 |
| Molecular Formula | C23H18NO5P |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-diphenylphosphorylpropanoic acid |
| SMILES | O=C(O)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H18NO5P/c25-21-18-13-7-8-14-19(18)22(26)24(21)20(23(27)28)15-30(29,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,27,28)/t20-/m1/s1 |
| InChIKey | QNURVPRFPYMDTF-HXUWFJFHSA-N |
| XLogP | 2.75 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|