About ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate
ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate (PubChem CID 24830868) has the molecular formula C21H22NO6P
and a molecular weight of 415.38 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate |
| PubChem CID | 24830868 |
| Molecular Formula | C21H22NO6P |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate |
| SMILES | CCOC(=O)C(CP(=O)(OCC)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H22NO6P/c1-3-27-21(25)18(14-29(26,28-4-2)15-10-6-5-7-11-15)22-19(23)16-12-8-9-13-17(16)20(22)24/h5-13,18H,3-4,14H2,1-2H3 |
| InChIKey | AKKIPKCJSJYVAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate?
The IUPAC name of ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate (CID 24830868) is ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate.
What is the SMILES notation for ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate?
The canonical SMILES for ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate is CCOC(=O)C(CP(=O)(OCC)c1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate?
The InChIKey is AKKIPKCJSJYVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22NO6P/c1-3-27-21(25)18(14-29(26,28-4-2)15-10-6-5-7-11-15)22-19(23)16-12-8-9-13-17(16)20(22)24/h5-13,18H,3-4,14H2,1-2H3.
What are the key properties of ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate?
ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate has a molecular weight of 415.38 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-dioxoisoindol-2-yl)-3-[ethoxy(phenyl)phosphoryl]propanoate is sourced from PubChem (CID 24830868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).