C20H16N2O5 — CID 169354571
ethyl 2-(1,3-dioxoisoindol-2-yl)-3-(4-isocyanatophenyl)propanoate (PubChem CID 169354571) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxoisoindol-2-yl)-3-(4-isocyanatophenyl)propanoate.
| Compound Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3-(4-isocyanatophenyl)propanoate |
|---|---|
| PubChem CID | 169354571 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3-(4-isocyanatophenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(N=C=O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O5/c1-2-27-20(26)17(11-13-7-9-14(10-8-13)21-12-23)22-18(24)15-5-3-4-6-16(15)19(22)25/h3-10,17H,2,11H2,1H3 |
| InChIKey | HITDWCUOAMHKPC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|