C21H20ClN3O4 — CID 169368158
ethyl 3-[4-[(1-amino-2-chloroethylidene)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 169368158) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is ethyl 3-[4-[(1-amino-2-chloroethylidene)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | ethyl 3-[4-[(1-amino-2-chloroethylidene)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 169368158 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | ethyl 3-[4-[(1-amino-2-chloroethylidene)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(/N=C(/N)CCl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20ClN3O4/c1-2-29-21(28)17(11-13-7-9-14(10-8-13)24-18(23)12-22)25-19(26)15-5-3-4-6-16(15)20(25)27/h3-10,17H,2,11-12H2,1H3,(H2,23,24) |
| InChIKey | SZUSCDVJBWAJEC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|