C26H20Cl2N2O5 — CID 1100533
ethyl (2S)-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1100533) has the molecular formula C26H20Cl2N2O5 and a molecular weight of 511.36 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | ethyl (2S)-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 1100533 |
| Molecular Formula | C26H20Cl2N2O5 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | ethyl (2S)-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H20Cl2N2O5/c1-2-35-26(34)22(30-24(32)19-5-3-4-6-20(19)25(30)33)11-15-7-9-18(10-8-15)29-14-16-12-17(27)13-21(28)23(16)31/h3-10,12-14,22,31H,2,11H2,1H3/b29-14+/t22-/m0/s1 |
| InChIKey | AACWRHFJUHVMRP-OFGWUUMASA-N |
| XLogP | 5.22 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|