C18H17Cl2NO4 — CID 1352916
ethyl (2S,3S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxy-3-phenylpropanoate (PubChem CID 1352916) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is ethyl (2S,3S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxy-3-phenylpropanoate.
| Compound Name | ethyl (2S,3S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 1352916 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | ethyl (2S,3S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxy-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](/N=C/c1cc(Cl)cc(Cl)c1O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-2-25-18(24)15(17(23)11-6-4-3-5-7-11)21-10-12-8-13(19)9-14(20)16(12)22/h3-10,15,17,22-23H,2H2,1H3/b21-10+/t15-,17-/m0/s1 |
| InChIKey | TZVGJHRBPGLYSA-FUYSCZTQSA-N |
| XLogP | 3.78 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|