C20H22Cl2N2O2 — CID 135758405
2,4-dichloro-6-[[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]iminomethyl]phenol (PubChem CID 135758405) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135758405 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2,4-dichloro-6-[[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]iminomethyl]phenol |
| SMILES | C[C@@H](/N=C/c1cc(Cl)cc(Cl)c1O)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-14(23-13-16-11-17(21)12-18(22)20(16)25)19(15-5-3-2-4-6-15)24-7-9-26-10-8-24/h2-6,11-14,19,25H,7-10H2,1H3/b23-13+/t14-,19+/m1/s1 |
| InChIKey | TWHUNFNOGXNIRA-HXCVSQATSA-N |
| XLogP | 4.58 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|