C27H30N6O4 — CID 169376759
ethyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 169376759) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is ethyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | ethyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 169376759 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | ethyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H30N6O4/c1-2-37-24(36)21(32-22(34)19-8-4-5-9-20(19)23(32)35)16-17-10-12-18(13-11-17)33-26(29)30-25(28)31-27(33)14-6-3-7-15-27/h4-5,8-13,21H,2-3,6-7,14-16H2,1H3,(H4,28,29,30,31) |
| InChIKey | VKHCTEQPNXVBDX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|