C15H21N7O — CID 169375975
[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]urea (PubChem CID 169375975) has the molecular formula C15H21N7O and a molecular weight of 315.38 g/mol. Its IUPAC name is [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]urea.
| Compound Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 169375975 |
| Molecular Formula | C15H21N7O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1 |
| InChI | InChI=1S/C15H21N7O/c16-12-20-13(17)22(15(21-12)8-2-1-3-9-15)11-6-4-10(5-7-11)19-14(18)23/h4-7H,1-3,8-9H2,(H3,18,19,23)(H4,16,17,20,21) |
| InChIKey | HFJVJFYLSUCKPY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |