C14H19N5O2S — CID 169376707
4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfinic acid (PubChem CID 169376707) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfinic acid.
| Compound Name | 4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfinic acid |
|---|---|
| PubChem CID | 169376707 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfinic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(S(=O)O)cc2)C(N)=N1 |
| InChI | InChI=1S/C14H19N5O2S/c15-12-17-13(16)19(14(18-12)8-2-1-3-9-14)10-4-6-11(7-5-10)22(20)21/h4-7H,1-3,8-9H2,(H,20,21)(H4,15,16,17,18) |
| InChIKey | ZFIKEXOPJASGSW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|