C24H36N6O — CID 169377406
[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone (PubChem CID 169377406) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone.
| Compound Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 169377406 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
| SMILES | CC1(C)CCCC(C)(C)N1C(=O)c1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1 |
| InChI | InChI=1S/C24H36N6O/c1-22(2)13-8-14-23(3,4)30(22)19(31)17-9-11-18(12-10-17)29-21(26)27-20(25)28-24(29)15-6-5-7-16-24/h9-12H,5-8,13-16H2,1-4H3,(H4,25,26,27,28) |
| InChIKey | GECWPAGRXKKYKN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |