C30H27N3O6 — CID 3112994
ethyl 3-[4-[(2-acetamido-3-phenylprop-2-enoyl)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3112994) has the molecular formula C30H27N3O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is ethyl 3-[4-[(2-acetamido-3-phenylprop-2-enoyl)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | ethyl 3-[4-[(2-acetamido-3-phenylprop-2-enoyl)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3112994 |
| Molecular Formula | C30H27N3O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | ethyl 3-[4-[(2-acetamido-3-phenylprop-2-enoyl)amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(NC(=O)C(=Cc2ccccc2)NC(C)=O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H27N3O6/c1-3-39-30(38)26(33-28(36)23-11-7-8-12-24(23)29(33)37)18-21-13-15-22(16-14-21)32-27(35)25(31-19(2)34)17-20-9-5-4-6-10-20/h4-17,26H,3,18H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | DQYKTOCQVPMCRF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|