C21H22NO6P — CID 14755430
2-(1-diethoxyphosphoryl-1-oxo-3-phenylpropan-2-yl)isoindole-1,3-dione (PubChem CID 14755430) has the molecular formula C21H22NO6P and a molecular weight of 415.38 g/mol. Its IUPAC name is 2-(1-diethoxyphosphoryl-1-oxo-3-phenylpropan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-diethoxyphosphoryl-1-oxo-3-phenylpropan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 14755430 |
| Molecular Formula | C21H22NO6P |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(1-diethoxyphosphoryl-1-oxo-3-phenylpropan-2-yl)isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)C(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H22NO6P/c1-3-27-29(26,28-4-2)21(25)18(14-15-10-6-5-7-11-15)22-19(23)16-12-8-9-13-17(16)20(22)24/h5-13,18H,3-4,14H2,1-2H3 |
| InChIKey | RHUCAZBTNZZLMF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|