C18H37N2O7P — CID 168960079
ethane;[(E)-3-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-4-methoxybut-1-enyl]-methoxyphosphinous acid (PubChem CID 168960079) has the molecular formula C18H37N2O7P and a molecular weight of 424.48 g/mol. Its IUPAC name is ethane;[(E)-3-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-4-methoxybut-1-enyl]-methoxyphosphinous acid.
| Compound Name | ethane;[(E)-3-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-4-methoxybut-1-enyl]-methoxyphosphinous acid |
|---|---|
| PubChem CID | 168960079 |
| Molecular Formula | C18H37N2O7P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | ethane;[(E)-3-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-4-methoxybut-1-enyl]-methoxyphosphinous acid |
| SMILES | CC.CC.COCC(/C=C/P(O)OC)OC(COC)N(C)/C=C\C(=O)NC=O |
| InChI | InChI=1S/C14H25N2O7P.2C2H6/c1-16(7-5-13(18)15-11-17)14(10-21-3)23-12(9-20-2)6-8-24(19)22-4;2*1-2/h5-8,11-12,14,19H,9-10H2,1-4H3,(H,15,17,18);2*1-2H3/b7-5-,8-6+;; |
| InChIKey | PXVVRKLTZLYALO-RRBJLESWSA-N |
| XLogP | 2.23 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|