C13H23N3O6S — CID 167508857
2-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-3-methoxy-N-methylsulfanylpropanamide (PubChem CID 167508857) has the molecular formula C13H23N3O6S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-3-methoxy-N-methylsulfanylpropanamide.
| Compound Name | 2-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-3-methoxy-N-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 167508857 |
| Molecular Formula | C13H23N3O6S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[1-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxyethoxy]-3-methoxy-N-methylsulfanylpropanamide |
| SMILES | COCC(OC(COC)N(C)/C=C\C(=O)NC=O)C(=O)NSC |
| InChI | InChI=1S/C13H23N3O6S/c1-16(6-5-11(18)14-9-17)12(8-21-3)22-10(7-20-2)13(19)15-23-4/h5-6,9-10,12H,7-8H2,1-4H3,(H,15,19)(H,14,17,18)/b6-5- |
| InChIKey | PKFDGHFAVHHORG-WAYWQWQTSA-N |
| XLogP | -0.90 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|