C14H27N2O8P — CID 172569518
(Z)-N-formyl-3-[methoxymethyl(methyl)amino]prop-2-enamide;[(E)-1-hydroxy-3,4-dimethoxybut-1-enyl]-methoxyphosphinous acid (PubChem CID 172569518) has the molecular formula C14H27N2O8P and a molecular weight of 382.35 g/mol. Its IUPAC name is (Z)-N-formyl-3-[methoxymethyl(methyl)amino]prop-2-enamide;[(E)-1-hydroxy-3,4-dimethoxybut-1-enyl]-methoxyphosphinous acid.
| Compound Name | (Z)-N-formyl-3-[methoxymethyl(methyl)amino]prop-2-enamide;[(E)-1-hydroxy-3,4-dimethoxybut-1-enyl]-methoxyphosphinous acid |
|---|---|
| PubChem CID | 172569518 |
| Molecular Formula | C14H27N2O8P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (Z)-N-formyl-3-[methoxymethyl(methyl)amino]prop-2-enamide;[(E)-1-hydroxy-3,4-dimethoxybut-1-enyl]-methoxyphosphinous acid |
| SMILES | COCC(/C=C(\O)P(O)OC)OC.COCN(C)/C=C\C(=O)NC=O |
| InChI | InChI=1S/C7H12N2O3.C7H15O5P/c1-9(6-12-2)4-3-7(11)8-5-10;1-10-5-6(11-2)4-7(8)13(9)12-3/h3-5H,6H2,1-2H3,(H,8,10,11);4,6,8-9H,5H2,1-3H3/b4-3-;7-4+ |
| InChIKey | SXYAJEVWUBUMPQ-ZCXGGZFISA-N |
| XLogP | 0.31 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|