C5H10O3 — CID 12962856
(2S)-2,3-dimethoxypropanal (PubChem CID 12962856) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is (2S)-2,3-dimethoxypropanal.
| Compound Name | (2S)-2,3-dimethoxypropanal |
|---|---|
| PubChem CID | 12962856 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (2S)-2,3-dimethoxypropanal |
| SMILES | COC[C@@H](C=O)OC |
| InChI | InChI=1S/C5H10O3/c1-7-4-5(3-6)8-2/h3,5H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | PNENILZGBBXDAG-RXMQYKEDSA-N |
| XLogP | -0.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|