C7H14O4 — CID 18716519
4-hydroxy-3,5-dimethoxypentanal (PubChem CID 18716519) has the molecular formula C7H14O4 and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethoxypentanal.
| Compound Name | 4-hydroxy-3,5-dimethoxypentanal |
|---|---|
| PubChem CID | 18716519 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4-hydroxy-3,5-dimethoxypentanal |
| SMILES | COCC(O)C(CC=O)OC |
| InChI | InChI=1S/C7H14O4/c1-10-5-6(9)7(11-2)3-4-8/h4,6-7,9H,3,5H2,1-2H3 |
| InChIKey | SFBPWIFTISUMSS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|