C6H14O4P2 — CID 58859582
(3R,4S)-3-(diphosphanyloxy)-4-hydroxy-5-methoxypentanal (PubChem CID 58859582) has the molecular formula C6H14O4P2 and a molecular weight of 212.12 g/mol. Its IUPAC name is (3R,4S)-3-(diphosphanyloxy)-4-hydroxy-5-methoxypentanal.
| Compound Name | (3R,4S)-3-(diphosphanyloxy)-4-hydroxy-5-methoxypentanal |
|---|---|
| PubChem CID | 58859582 |
| Molecular Formula | C6H14O4P2 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (3R,4S)-3-(diphosphanyloxy)-4-hydroxy-5-methoxypentanal |
| SMILES | COC[C@H](O)[C@@H](CC=O)OPP |
| InChI | InChI=1S/C6H14O4P2/c1-9-4-5(8)6(2-3-7)10-12-11/h3,5-6,8,12H,2,4,11H2,1H3/t5-,6+/m0/s1 |
| InChIKey | VDEJJZKOIIXREI-NTSWFWBYSA-N |
| XLogP | 0.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|