C17H35FN2O4 — CID 153342336
ethane;(Z)-3-[(3-ethyl-3-fluoropentyl)-methylamino]-N-formylprop-2-enamide;propane-2,2-diol (PubChem CID 153342336) has the molecular formula C17H35FN2O4 and a molecular weight of 350.48 g/mol. Its IUPAC name is ethane;(Z)-3-[(3-ethyl-3-fluoropentyl)-methylamino]-N-formylprop-2-enamide;propane-2,2-diol.
| Compound Name | ethane;(Z)-3-[(3-ethyl-3-fluoropentyl)-methylamino]-N-formylprop-2-enamide;propane-2,2-diol |
|---|---|
| PubChem CID | 153342336 |
| Molecular Formula | C17H35FN2O4 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | ethane;(Z)-3-[(3-ethyl-3-fluoropentyl)-methylamino]-N-formylprop-2-enamide;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CCC(F)(CC)CCN(C)/C=C\C(=O)NC=O |
| InChI | InChI=1S/C12H21FN2O2.C3H8O2.C2H6/c1-4-12(13,5-2)7-9-15(3)8-6-11(17)14-10-16;1-3(2,4)5;1-2/h6,8,10H,4-5,7,9H2,1-3H3,(H,14,16,17);4-5H,1-2H3;1-2H3/b8-6-;; |
| InChIKey | IVNOLFPSNQVNOJ-OTDBEEGXSA-N |
| XLogP | 2.36 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|