C10H15FN2O4 — CID 139479096
(Z)-3-[[5-fluoro-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide (PubChem CID 139479096) has the molecular formula C10H15FN2O4 and a molecular weight of 246.24 g/mol. Its IUPAC name is (Z)-3-[[5-fluoro-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide.
| Compound Name | (Z)-3-[[5-fluoro-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
|---|---|
| PubChem CID | 139479096 |
| Molecular Formula | C10H15FN2O4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (Z)-3-[[5-fluoro-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
| SMILES | CN(/C=C\C(=O)NC=O)C1CCC(F)(CO)O1 |
| InChI | InChI=1S/C10H15FN2O4/c1-13(5-3-8(16)12-7-15)9-2-4-10(11,6-14)17-9/h3,5,7,9,14H,2,4,6H2,1H3,(H,12,15,16)/b5-3- |
| InChIKey | HARWFPSNDJQCEA-HYXAFXHYSA-N |
| XLogP | -0.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|