C15H24N2O4 — CID 163227450
ethane;(Z)-3-[[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide (PubChem CID 163227450) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethane;(Z)-3-[[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide.
| Compound Name | ethane;(Z)-3-[[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 163227450 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | ethane;(Z)-3-[[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide |
| SMILES | C#CC1(CO)CCC(N(C)/C=C(/C)C(=O)NC=O)O1.CC |
| InChI | InChI=1S/C13H18N2O4.C2H6/c1-4-13(8-16)6-5-11(19-13)15(3)7-10(2)12(18)14-9-17;1-2/h1,7,9,11,16H,5-6,8H2,2-3H3,(H,14,17,18);1-2H3/b10-7-; |
| InChIKey | MPGZDONQFJYELG-VEZAGKLZSA-N |
| XLogP | 0.62 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|