C9H17NO2 — CID 142271872
ethane;N-formyl-2,3-dimethylbut-2-enamide (PubChem CID 142271872) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is ethane;N-formyl-2,3-dimethylbut-2-enamide.
| Compound Name | ethane;N-formyl-2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 142271872 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethane;N-formyl-2,3-dimethylbut-2-enamide |
| SMILES | CC.CC(C)=C(C)C(=O)NC=O |
| InChI | InChI=1S/C7H11NO2.C2H6/c1-5(2)6(3)7(10)8-4-9;1-2/h4H,1-3H3,(H,8,9,10);1-2H3 |
| InChIKey | GBBBBNNERZVMMB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|