C6H10BrNO — CID 175154463
N-bromo-2,3-dimethylbut-2-enamide (PubChem CID 175154463) has the molecular formula C6H10BrNO and a molecular weight of 192.06 g/mol. Its IUPAC name is N-bromo-2,3-dimethylbut-2-enamide.
| Compound Name | N-bromo-2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 175154463 |
| Molecular Formula | C6H10BrNO |
| Molecular Weight | 192.06 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | N-bromo-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NBr |
| InChI | InChI=1S/C6H10BrNO/c1-4(2)5(3)6(9)8-7/h1-3H3,(H,8,9) |
| InChIKey | BZCYRIFTSZTAGR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.06 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|