C11H19NO — CID 130884658
N-[(1R,2R)-2-ethylcyclopropyl]-2,3-dimethylbut-2-enamide (PubChem CID 130884658) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(1R,2R)-2-ethylcyclopropyl]-2,3-dimethylbut-2-enamide.
| Compound Name | N-[(1R,2R)-2-ethylcyclopropyl]-2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 130884658 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(1R,2R)-2-ethylcyclopropyl]-2,3-dimethylbut-2-enamide |
| SMILES | CC[C@@H]1C[C@H]1NC(=O)C(C)=C(C)C |
| InChI | InChI=1S/C11H19NO/c1-5-9-6-10(9)12-11(13)8(4)7(2)3/h9-10H,5-6H2,1-4H3,(H,12,13)/t9-,10-/m1/s1 |
| InChIKey | NKEMVAVGGPEJOZ-NXEZZACHSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|