C10H17NO2 — CID 91262324
2,3-dimethyl-N-(2-oxobutyl)but-2-enamide (PubChem CID 91262324) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,3-dimethyl-N-(2-oxobutyl)but-2-enamide.
| Compound Name | 2,3-dimethyl-N-(2-oxobutyl)but-2-enamide |
|---|---|
| PubChem CID | 91262324 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2,3-dimethyl-N-(2-oxobutyl)but-2-enamide |
| SMILES | CCC(=O)CNC(=O)C(C)=C(C)C |
| InChI | InChI=1S/C10H17NO2/c1-5-9(12)6-11-10(13)8(4)7(2)3/h5-6H2,1-4H3,(H,11,13) |
| InChIKey | YMWGPHCRVVEIJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|