C8H17ClN2O — CID 139668609
2-(2,3-dimethylbut-2-enoylamino)ethylazanium chloride (PubChem CID 139668609) has the molecular formula C8H17ClN2O and a molecular weight of 192.69 g/mol. Its IUPAC name is 2-(2,3-dimethylbut-2-enoylamino)ethylazanium chloride.
| Compound Name | 2-(2,3-dimethylbut-2-enoylamino)ethylazanium chloride |
|---|---|
| PubChem CID | 139668609 |
| Molecular Formula | C8H17ClN2O |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-(2,3-dimethylbut-2-enoylamino)ethylazanium chloride |
| SMILES | CC(C)=C(C)C(=O)NCC[NH3+].[Cl-] |
| InChI | InChI=1S/C8H16N2O.ClH/c1-6(2)7(3)8(11)10-5-4-9;/h4-5,9H2,1-3H3,(H,10,11);1H |
| InChIKey | CWDMOCBHMRCNGF-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|