About acetic acid;oxalic acid;hydrate
acetic acid;oxalic acid;hydrate (PubChem CID 175212371) has the molecular formula C4H8O7
and a molecular weight of 168.10 g/mol. Its IUPAC name is acetic acid;oxalic acid;hydrate.
Molecular Properties
| Compound Name | acetic acid;oxalic acid;hydrate |
| PubChem CID | 175212371 |
| Molecular Formula | C4H8O7 |
| Molecular Weight | 168.10 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | acetic acid;oxalic acid;hydrate |
| SMILES | CC(=O)O.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C2H2O4.C2H4O2.H2O/c3-1(4)2(5)6;1-2(3)4;/h(H,3,4)(H,5,6);1H3,(H,3,4);1H2 |
| InChIKey | CHEMTYJGDKDYJK-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.10 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;oxalic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;oxalic acid;hydrate?
The IUPAC name of acetic acid;oxalic acid;hydrate (CID 175212371) is acetic acid;oxalic acid;hydrate.
What is the SMILES notation for acetic acid;oxalic acid;hydrate?
The canonical SMILES for acetic acid;oxalic acid;hydrate is CC(=O)O.O.O=C(O)C(=O)O.
What is the InChIKey of acetic acid;oxalic acid;hydrate?
The InChIKey is CHEMTYJGDKDYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.C2H4O2.H2O/c3-1(4)2(5)6;1-2(3)4;/h(H,3,4)(H,5,6);1H3,(H,3,4);1H2.
What are the key properties of acetic acid;oxalic acid;hydrate?
acetic acid;oxalic acid;hydrate has a molecular weight of 168.10 g/mol, XLogP of -1.58, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;oxalic acid;hydrate is sourced from PubChem (CID 175212371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).