C4H5F2NO — CID 174767420
N-(1,1-difluoroprop-1-en-2-yl)formamide (PubChem CID 174767420) has the molecular formula C4H5F2NO and a molecular weight of 121.09 g/mol. Its IUPAC name is N-(1,1-difluoroprop-1-en-2-yl)formamide.
| Compound Name | N-(1,1-difluoroprop-1-en-2-yl)formamide |
|---|---|
| PubChem CID | 174767420 |
| Molecular Formula | C4H5F2NO |
| Molecular Weight | 121.09 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | N-(1,1-difluoroprop-1-en-2-yl)formamide |
| SMILES | CC(NC=O)=C(F)F |
| InChI | InChI=1S/C4H5F2NO/c1-3(4(5)6)7-2-8/h2H,1H3,(H,7,8) |
| InChIKey | QOLLXVQXDGPIRA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.09 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|