C21H35IN5O5P — CID 168936489
(Z)-3-[[(5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-[(iodoamino)methyl]-5-methyl-2H-furan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide (PubChem CID 168936489) has the molecular formula C21H35IN5O5P and a molecular weight of 595.42 g/mol. Its IUPAC name is (Z)-3-[[(5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-[(iodoamino)methyl]-5-methyl-2H-furan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide.
| Compound Name | (Z)-3-[[(5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-[(iodoamino)methyl]-5-methyl-2H-furan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 168936489 |
| Molecular Formula | C21H35IN5O5P |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | (Z)-3-[[(5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-[(iodoamino)methyl]-5-methyl-2H-furan-2-yl]-methylamino]-N-formyl-2-methylprop-2-enamide |
| SMILES | C/C(=C/N(C)C1C=C(OP(OCCC#N)N(C(C)C)C(C)C)[C@@](C)(CNI)O1)C(=O)NC=O |
| InChI | InChI=1S/C21H35IN5O5P/c1-15(2)27(16(3)4)33(30-10-8-9-23)32-18-11-19(31-21(18,6)13-25-22)26(7)12-17(5)20(29)24-14-28/h11-12,14-16,19,25H,8,10,13H2,1-7H3,(H,24,28,29)/b17-12-/t19?,21-,33?/m1/s1 |
| InChIKey | WVYOTDBMHBBQBT-DVJZGJHSSA-N |
| XLogP | 3.33 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|