C17H34N3O3P — CID 170287950
N-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2,4-dimethylpentan-2-yl]formamide (PubChem CID 170287950) has the molecular formula C17H34N3O3P and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2,4-dimethylpentan-2-yl]formamide.
| Compound Name | N-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2,4-dimethylpentan-2-yl]formamide |
|---|---|
| PubChem CID | 170287950 |
| Molecular Formula | C17H34N3O3P |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2,4-dimethylpentan-2-yl]formamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC(C)(C)CC(C)(C)NC=O |
| InChI | InChI=1S/C17H34N3O3P/c1-14(2)20(15(3)4)24(22-11-9-10-18)23-17(7,8)12-16(5,6)19-13-21/h13-15H,9,11-12H2,1-8H3,(H,19,21) |
| InChIKey | WCTBEWVYRMMZAY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|