C29H57N4O4P — CID 135293031
N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-(2,2,4,4-tetramethylpentanoylamino)ethyl]-2,2,4,4-tetramethylpentanamide (PubChem CID 135293031) has the molecular formula C29H57N4O4P and a molecular weight of 556.77 g/mol. Its IUPAC name is N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-(2,2,4,4-tetramethylpentanoylamino)ethyl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-(2,2,4,4-tetramethylpentanoylamino)ethyl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 135293031 |
| Molecular Formula | C29H57N4O4P |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-(2,2,4,4-tetramethylpentanoylamino)ethyl]-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC(CNC(=O)C(C)(C)CC(C)(C)C)NC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C29H57N4O4P/c1-21(2)33(22(3)4)38(36-17-15-16-30)37-23(32-25(35)29(13,14)20-27(8,9)10)18-31-24(34)28(11,12)19-26(5,6)7/h21-23H,15,17-20H2,1-14H3,(H,31,34)(H,32,35) |
| InChIKey | MVEYDBOAIRTGTD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|