C11H20N2O4 — CID 145471178
(Z)-N-formyl-3-[(4-hydroxy-3-methoxybutyl)-methylamino]-2-methylprop-2-enamide (PubChem CID 145471178) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is (Z)-N-formyl-3-[(4-hydroxy-3-methoxybutyl)-methylamino]-2-methylprop-2-enamide.
| Compound Name | (Z)-N-formyl-3-[(4-hydroxy-3-methoxybutyl)-methylamino]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 145471178 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (Z)-N-formyl-3-[(4-hydroxy-3-methoxybutyl)-methylamino]-2-methylprop-2-enamide |
| SMILES | COC(CO)CCN(C)/C=C(/C)C(=O)NC=O |
| InChI | InChI=1S/C11H20N2O4/c1-9(11(16)12-8-15)6-13(2)5-4-10(7-14)17-3/h6,8,10,14H,4-5,7H2,1-3H3,(H,12,15,16)/b9-6- |
| InChIKey | XJCZZVHWLYMTJI-TWGQIWQCSA-N |
| XLogP | -0.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|