About acetic acid;2-methoxyhexan-1-ol
acetic acid;2-methoxyhexan-1-ol (PubChem CID 71318556) has the molecular formula C9H20O4
and a molecular weight of 192.25 g/mol. Its IUPAC name is acetic acid;2-methoxyhexan-1-ol.
Molecular Properties
| Compound Name | acetic acid;2-methoxyhexan-1-ol |
| PubChem CID | 71318556 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | acetic acid;2-methoxyhexan-1-ol |
| SMILES | CC(=O)O.CCCCC(CO)OC |
| InChI | InChI=1S/C7H16O2.C2H4O2/c1-3-4-5-7(6-8)9-2;1-2(3)4/h7-8H,3-6H2,1-2H3;1H3,(H,3,4) |
| InChIKey | HVVRGFBAONQVJA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;2-methoxyhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methoxyhexan-1-ol?
The IUPAC name of acetic acid;2-methoxyhexan-1-ol (CID 71318556) is acetic acid;2-methoxyhexan-1-ol.
What is the SMILES notation for acetic acid;2-methoxyhexan-1-ol?
The canonical SMILES for acetic acid;2-methoxyhexan-1-ol is CC(=O)O.CCCCC(CO)OC.
What is the InChIKey of acetic acid;2-methoxyhexan-1-ol?
The InChIKey is HVVRGFBAONQVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C2H4O2/c1-3-4-5-7(6-8)9-2;1-2(3)4/h7-8H,3-6H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methoxyhexan-1-ol?
acetic acid;2-methoxyhexan-1-ol has a molecular weight of 192.25 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methoxyhexan-1-ol is sourced from PubChem (CID 71318556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).