About 9-methoxyhexadec-2-enoic acid
9-methoxyhexadec-2-enoic acid (PubChem CID 163192644) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 9-methoxyhexadec-2-enoic acid.
Molecular Properties
| Compound Name | 9-methoxyhexadec-2-enoic acid |
| PubChem CID | 163192644 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 9-methoxyhexadec-2-enoic acid |
| SMILES | CCCCCCCC(CCCCCC=CC(=O)O)OC |
| InChI | InChI=1S/C17H32O3/c1-3-4-5-7-10-13-16(20-2)14-11-8-6-9-12-15-17(18)19/h12,15-16H,3-11,13-14H2,1-2H3,(H,18,19) |
| InChIKey | DXPLERKXLNINIS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 9-methoxyhexadec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxyhexadec-2-enoic acid?
The IUPAC name of 9-methoxyhexadec-2-enoic acid (CID 163192644) is 9-methoxyhexadec-2-enoic acid.
What is the SMILES notation for 9-methoxyhexadec-2-enoic acid?
The canonical SMILES for 9-methoxyhexadec-2-enoic acid is CCCCCCCC(CCCCCC=CC(=O)O)OC.
What is the InChIKey of 9-methoxyhexadec-2-enoic acid?
The InChIKey is DXPLERKXLNINIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-3-4-5-7-10-13-16(20-2)14-11-8-6-9-12-15-17(18)19/h12,15-16H,3-11,13-14H2,1-2H3,(H,18,19).
What are the key properties of 9-methoxyhexadec-2-enoic acid?
9-methoxyhexadec-2-enoic acid has a molecular weight of 284.44 g/mol, XLogP of 4.95, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxyhexadec-2-enoic acid is sourced from PubChem (CID 163192644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).