C14H28O3 — CID 88582161
7-methoxy-2,2-dimethylundecanoic acid (PubChem CID 88582161) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethylundecanoic acid.
| Compound Name | 7-methoxy-2,2-dimethylundecanoic acid |
|---|---|
| PubChem CID | 88582161 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 7-methoxy-2,2-dimethylundecanoic acid |
| SMILES | CCCCC(CCCCC(C)(C)C(=O)O)OC |
| InChI | InChI=1S/C14H28O3/c1-5-6-9-12(17-4)10-7-8-11-14(2,3)13(15)16/h12H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | KMPPSFVPXLVBDI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|