C20H46O11 — CID 173046778
2-butoxyhexan-1-ol;tris(ethane-1,2-diol);3-oxobutanoic acid (PubChem CID 173046778) has the molecular formula C20H46O11 and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-butoxyhexan-1-ol;tris(ethane-1,2-diol);3-oxobutanoic acid.
| Compound Name | 2-butoxyhexan-1-ol;tris(ethane-1,2-diol);3-oxobutanoic acid |
|---|---|
| PubChem CID | 173046778 |
| Molecular Formula | C20H46O11 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 2-butoxyhexan-1-ol;tris(ethane-1,2-diol);3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.CCCCOC(CO)CCCC.OCCO.OCCO.OCCO |
| InChI | InChI=1S/C10H22O2.C4H6O3.3C2H6O2/c1-3-5-7-10(9-11)12-8-6-4-2;1-3(5)2-4(6)7;3*3-1-2-4/h10-11H,3-9H2,1-2H3;2H2,1H3,(H,6,7);3*3-4H,1-2H2 |
| InChIKey | ZYWYBWARVVUNKK-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|