C20H27FN2O5 — CID 145107346
ethane;(Z)-3-[[5-(fluoromethyl)-3-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide (PubChem CID 145107346) has the molecular formula C20H27FN2O5 and a molecular weight of 394.44 g/mol. Its IUPAC name is ethane;(Z)-3-[[5-(fluoromethyl)-3-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide.
| Compound Name | ethane;(Z)-3-[[5-(fluoromethyl)-3-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
|---|---|
| PubChem CID | 145107346 |
| Molecular Formula | C20H27FN2O5 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethane;(Z)-3-[[5-(fluoromethyl)-3-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
| SMILES | CC.CN(/C=C\C(=O)NC=O)C1OC(CF)(COCc2ccccc2)CC1=O |
| InChI | InChI=1S/C18H21FN2O5.C2H6/c1-21(8-7-16(24)20-13-22)17-15(23)9-18(11-19,26-17)12-25-10-14-5-3-2-4-6-14;1-2/h2-8,13,17H,9-12H2,1H3,(H,20,22,24);1-2H3/b8-7-; |
| InChIKey | JTJGVZYILUUDGY-CFYXSCKTSA-N |
| XLogP | 1.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|