C16H24BNO3 — CID 156676198
CID 156676198 (PubChem CID 156676198) has the molecular formula C16H24BNO3 and a molecular weight of 289.18 g/mol.
| Compound Name | CID 156676198 |
|---|---|
| PubChem CID | 156676198 |
| Molecular Formula | C16H24BNO3 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CN(C(C)C)C[C@@](CO)(COCc2ccccc2)O1 |
| InChI | InChI=1S/C16H24BNO3/c1-13(2)18-8-15(17)21-16(10-18,11-19)12-20-9-14-6-4-3-5-7-14/h3-7,13,15,19H,8-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | XVUWCWXYCBXFCU-HZPDHXFCSA-N |
| XLogP | 1.17 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|