C13H12F2INO3 — CID 71744036
benzyl 3,3-difluoro-4-(iodomethyl)-2-oxopyrrolidine-1-carboxylate (PubChem CID 71744036) has the molecular formula C13H12F2INO3 and a molecular weight of 395.14 g/mol. Its IUPAC name is benzyl 3,3-difluoro-4-(iodomethyl)-2-oxopyrrolidine-1-carboxylate.
| Compound Name | benzyl 3,3-difluoro-4-(iodomethyl)-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71744036 |
| Molecular Formula | C13H12F2INO3 |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | benzyl 3,3-difluoro-4-(iodomethyl)-2-oxopyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC(CI)C(F)(F)C1=O |
| InChI | InChI=1S/C13H12F2INO3/c14-13(15)10(6-16)7-17(11(13)18)12(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | LENBKCFEOXRAFP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|