C15H19F2NO2 — CID 175946154
benzyl (2R,6S)-4,4-difluoro-2,6-dimethylpiperidine-1-carboxylate (PubChem CID 175946154) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is benzyl (2R,6S)-4,4-difluoro-2,6-dimethylpiperidine-1-carboxylate.
| Compound Name | benzyl (2R,6S)-4,4-difluoro-2,6-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175946154 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | benzyl (2R,6S)-4,4-difluoro-2,6-dimethylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CC(F)(F)C[C@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19F2NO2/c1-11-8-15(16,17)9-12(2)18(11)14(19)20-10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12+ |
| InChIKey | JFYVKOYIBBXVRR-TXEJJXNPSA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |