C13H14F2N2O3 — CID 58786847
benzyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate (PubChem CID 58786847) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is benzyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58786847 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | benzyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate |
| SMILES | NC(=O)[C@@H]1CC(F)(F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H14F2N2O3/c14-13(15)6-10(11(16)18)17(8-13)12(19)20-7-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,16,18)/t10-/m0/s1 |
| InChIKey | NDGAWGQVOGFKMT-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |